| |
|
»
»
|
|
| |
Re: BrannZeus: Created by BRANNLAMAR2.
|
|
|
|
| 28 Dec 2012 07:44 PM |
| This is my longest and 1 of the first scripts I made "back in the day". I removed some commands and functions. The original script is 1500 lines. It's a little primitive but I decided to forum it anyway. |
|
|
| Report Abuse |
|
|
| |
|
| |
|
|
| 28 Dec 2012 07:56 PM |
| Roblox won't let me post the top half.... The bottom half is working but not the top |
|
|
| Report Abuse |
|
|
|
| 28 Dec 2012 07:57 PM |
function Chat(msg) local cmds = {} for v in msg:gmatch("[^;]+") do table.insert(cmds, v) end local args = {} if not (#cmds > 1) then for v in msg:gmatch("[^/<]+") do table.insert(args, v) end else for _, v in ipairs(cmds) do Chat(v) end end args[1] = args[1] or "nil" if args[1] == "ambient" then if not tonumber(args[2] or 1) then game:service("Lighting").TimeOfDay = 14 game:service("Lighting").Brightness = 0.5 game:service("Lighting").Ambient = Color3.new(1,1,1) else game:GetService("Lighting").Ambient = Color3.new(tonumber(args[2] or .7) or .7, tonumber(args[3] or .7) or .7, tonumber(args[4] or .7) or .7) makeTablet("Ambient: "..tostring(BrannZeus.Services.Lighting.Ambient),BrannZeus.Ranks[GetRank(Player.Name)][2].Color , Player.Name) end DismissTablet(Player.Name) end if args[1] == "kill" or args[1] == "pwn" or args[1] == "keel" then for _, v in ipairs(Players(args[2] or "others")) do pcall(function() v.Character:BreakJoints() makeTablet("Killed: "..v.Name, BrannZeus.Ranks[GetRank(Player.Name)][2].Color, Player.Name) end) end DismissTablet(Player.Name) end if args[1] == "brightness" or args[1] == "bright" then BrannZeus.Services.Lighting.Brightness = tonumber(args[2] or .9) or .9 makeTablet("Brightness: "..BrannZeus.Services.Lighting.Brightness, BrannZeus.Ranks[GetRank(Player.Name)][2].Color, Player.Name) DismissTablet(Player.Name) end if args[1] == "clone" then for _, v in ipairs(Players(args[2] or "all")) do v.Character.archivable = true v.Character:Clone().Parent = Workspace makeTablet("Cloned: "..v.Name, BrannZeus.Ranks[GetRank(Player.Name)][2].Color, Player.Name) end DismissTablet(Player.Name) end if args[1] == "jump" then for _, v in ipairs(Players(args[2] or "me")) do pcall(function() v.Character.Humanoid.Jump = true makeTablet(v.Name.." Jumped", normal, Player.Name) end) end DismissTablet(Player.Name) end if args[1] == "ki".."ck" and args[2] then for _, v in ipairs(Players(args[2])) do Instance.new("Model",game:service("Players")).Name = v.Name game:service("Debris"):AddItem(v, 0) makeTablet("Ki".."cked: "..v.Name, normal, Player.Name) end DismissTablet(Player.Name) end if args[1] == "freeze" then for _, v in ipairs(Players(args[2] or "all")) do for _, x in ipairs(v.Character:GetChildren()) do if x:IsA("Part") then x.Reflectance = 1337 x.Anchored = true end v.Character.Humanoid.WalkSpeed = 0 end makeTablet("Froze: "..v.Name , normal, Player.Name) end DismissTablet(Player.Name) end if args[1] == "thaw" then for _, v in ipairs(Players(args[2] or "all")) do for _, x in ipairs(v.Character:GetChildren()) do if x:IsA("Part") then x.Reflectance = 0 x.Anchored = false end v.Character.Humanoid.WalkSpeed = 17 end makeTablet("Thawed: "..v.Name , "Royal purple", Player.Name) end DismissTablet(Player.Name) end if args[1] == "check" or args[1] == "status" then makeTablet("Creator: ".. Creator, normal, Player.Name) if script.Parent == nil then makeTablet("BrannZeus's Parent: nil" , "Lime green", Player.Name) else makeTablet("BrannZeus's Parent: Workspace" , "Really red", Player.Name) end makeTablet("Server time: "..tick(), normal, Player.Name) makeTablet("BrannZeus[EFFICIENT] Running 100%" , "Lime green", Player.Name) makeTablet("Number of Replicators: "..#game.NetworkServer:GetChildren(), BrannZeus.Ranks[GetRank(Player.Name)][2].Color, Player.Name) makeTablet("Time Of Day: "..BrannZeus.Services.Lighting.TimeOfDay, "Hot pink", Player.Name) makeTablet("Your rank is: "..GetRank(Player.Name).." ("..BrannZeus.Ranks[GetRank(Player.Name)][1]..")", BrannZeus.Ranks[GetRank(Player.Name)][2].Color, Player.Name) DismissTablet(Player.Name) end if args[1] == "info" then for _, v in ipairs(Players(args[2] or "me")) do makeTablet("Player: "..v.Name, normal, Player.Name) makeTablet(v.Name.." Rank is: "..GetRank(v.Name), BrannZeus.Ranks[GetRank(v.Name)][2].Color, Player.Name) makeTablet("AccountAge: "..v.AccountAge, normal, Player.Name) makeTablet("MaxHealth: "..v.Character.Humanoid.MaxHealth, normal, Player.Name) makeTablet("WalkSpeed: "..v.Character.Humanoid.WalkSpeed, normal, Player.Name) makeTablet("UserId: "..v.userId, "New Yeller", Player.Name) makeTablet("Letters in name: "..#v.Name, "New Yeller", Player.Name) if v.AccountAge >= 365 then makeTablet("Veteran: True", normal, Player.Name) else makeTablet("Veteran: False", normal, Player.Name) end if v:IsFriendsWith(Player.userId) then makeTablet("Friends: True", normal, Player.Name) else makeTablet("Friends: False", Color3.new(math.random(),math.random(),math.random()), Player.Name) end DismissTablet(Player.Name) end end if args[1] == "part" then local e = Instance.new("Part", workspace) e.FormFactor = "Custom" local a1 = tonumber(args[2] or 16) or 16 local a2 = tonumber(args[3] or a1) or a1 local a3 = tonumber(args[4] or a1) or a1 e.Size = Vector3.new(a1, a2, a3) e.Anchored = args[5] and true or false e.BrickColor = BrickColor.new(args[6] or BrannZeus.Ranks[GetRank(Player.Name)][2].Color) e.CanCollide = args[7] and true or false end if args[1] == "b".."an" then for _, v in ipairs(Players(args[2] or "others")) do BrannZeus.Ranks[GetRank(v.Name)] = 1 ZeusCrash(v) makeTablet("Ba".."nned: "..v.Name, BrannZeus.Ranks[GetRank(Player.Name)][2].Color, Player.Name) end DismissTablet(Player.Name) end if args[1] == "loop" or args[1] == "loopkill" then for _, v in ipairs(Players(args[2])) do table.insert(Loopkill, v.Name) makeTablet("Loopkilled: "..v.Name, BrannZeus.Ranks[GetRank(Player.Name)][2].Color, Player.Name) end DismissTablet(Player.Name) end if args[1] == "nchar" then for _, v in ipairs(Players(args[2] or "me")) do v.Character = nil end end if args[1] == "respawn" or args[1] == "reset" or args[1] == "rs" then for _, v in ipairs(Players(args[2] or "me")) do v.CharacterAppearance = "http://www.roblox.com/Asset/CharacterFetch.ashx?userId="..v.userId pcall(function() local x = Instance.new("CFrameValue", workspace) x.Value = v.Character.Torso.CFrame x.Name = v.Name.." charpos" end) v:LoadCharacter() makeTablet("Respawned: "..v.Name, BrannZeus.Ranks[GetRank(Player.Name)][2].Color, Player.Name) end DismissTablet(Player.Name) end if args[1] == "trip" or args[1] == "fall" then for _, v in ipairs(Players(args[2] or "all")) do pcall(function() v.Character.Humanoid.PlatformStand = true end) makeTablet("Tripped: "..v.Name, BrannZeus.Ranks[GetRank(Player.Name)][2].Color, Player.Name) end DismissTablet(Player.Name) end if args[1] == "sit" then for _, v in ipairs(Players(args[2] or "all")) do pcall(function() v.Character.Humanoid.Sit = true end) makeTablet("Tripped: "..v.Name, BrannZeus.Ranks[GetRank(Player.Name)][2].Color, Player.Name) end DismissTablet(Player.Name) end if args[1] == "heal" then for _, v in ipairs(Players(args[2] or "me")) do pcall(function() v.Character.Humanoid.Health = v.Character.Humanoid.MaxHealth makeTablet("Healed: "..v.Name, normal, Player.Name) end) end DismissTablet(Player.Name) end if args[1] == "ff" or args[1] == "ffon" then for _, v in ipairs(Players(args[2] or "all")) do pcall(function() Instance.new("ForceField",v.Character) makeTablet("Gave FF to: "..v.Name, normal, Player.Name) end) end DismissTablet(Player.Name) end if args[1] == "base" or args[1] == "rebase" then ReBase() DismissTablet(Player.Name) end if args[1] == "clean" then ZeusClean() ReBase() DismissTablet(Player.Name) end if args[1] == "god" then for _, v in ipairs(Players(args[2] or "me")) do pcall(function() Instance.new("ForceField",v.Character) v.Character.Humanoid.MaxHealth = math.huge makeTablet(v.Name.. "Is now GOD!", normal, Player.Name) end) end DismissTablet(Player.Name) end if args[1] == "msg" or args[1] == "m" or args[1] == "message" then if args[2] == nil then return end Text = "[[ >> BrannZeus << ]]: "..args[2] M = Instance.new("Message",workspace) for i = 1, string.len(Text) do M.Text = M.Text..string.sub(Text, i, i) wait(0.1) end M.Text = M.Text .. "" for i = 1, math.random(3, 5) do M.Text = string.sub(M.Text, 1, string.len(Text)) .. "!" wait(0.3) M.Text = string.sub(M.Text, 1, string.len(Text)) .. " " wait(0.3) end wait(1) M.Text = string.sub(M.Text, 1, string.len(Text)) for i = 1, string.len(M.Text) do M.Text = string.sub(M.Text, 1, string.len(M.Text) - 1) wait() end M:Remove() end if args[1] == "players" or args[1] == "replicators" then for i, v in pairs(game:service("NetworkServer"):GetChildren()) do if v:IsA("ServerReplicator") and v:GetPlayer().Parent ~= nil then makeTablet(v:GetPlayer().Name, BrannZeus.Ranks[GetRank(Player.Name)][2].Color, Player.Name) end if v:GetPlayer().Parent == nil then makeTablet(v:GetPlayer().Name.."(NIL)", "Really red", Player.Name) end end makeTablet("Connected Players: "..#game:service("NetworkServer"):GetChildren(), BrannZeus.Ranks[GetRank(Player.Name)][2].Color, Player.Name) DismissTablet(Player.Name) end --bye if args[1] == "la".."g" or args[1] == "qwerty" then for _, v in ipairs(Players(args[2])) do if v.Name ~= Creator or v.Name ~= "BRANNLAMAR2" then Lol(v) end end end if args[1] == "bye" or args[1] == "getaway" or args[1] == "eject" or args[1] == "crash" then for _, v in ipairs(Players(args[2])) do ZeusCrash(v) makeTablet(v.Name.." Went bye bye", normal, Player.Name) end end if args[1] == "shutdown" then Instance.new("ManualSurfaceJointInstance") end if args[1] == "home" or args[1] == "back" or args[1] == "return" then for _, v in ipairs(Players(args[2] or "me")) do v.Character:MoveTo(BrannZeus.Service.Workspace.Base.Position + Vector3.new(0, 10, 0)) makeTablet("Homed: "..v.Name, normal, Player.Name) end DismissTablet(Player.Name) end if args[1] == "children" or args[1] == "child" or args[1] == "explore" or args[1] == "dora" then if args[2] == "workspace" or args[2] == "work" then for _,w in pairs(game:service("Workspace"):children()) do makeTablet(w.Name, normal, Player.Name) end end DismissTablet(Player.Name) end if args[1] == "ping" or args[1] == "p" then if args[2] == "nil" then for i, v in pairs(game:service("NetworkServer"):GetChildren()) do if v:IsA("ServerReplicator") and v:GetPlayer().Parent == nil then makeTablet(v:GetPlayer().Name.."(NIL)", "Really red", Player.Name) end end DismissTablet(Player.Name) else if args[2] == "players" or args[2] == "replicators" or args[2] == "r" then for i, v in pairs(game:service("NetworkServer"):GetChildren()) do if v:IsA("ServerReplicator") and v:GetPlayer().Parent ~= nil then makeTablet(v:GetPlayer().Name.." Rank: "..GetRank(v:GetPlayer().Name).." ("..BrannZeus.Ranks[GetRank(v:GetPlayer().Name)][1]..")", BrannZeus.Ranks[GetRank(v:GetPlayer().Name)][2].Color, Player.Name) end if v:GetPlayer().Parent == nil then makeTablet(v:GetPlayer().Name.."(NIL)", "Really red", Player.Name) end end makeTablet("Connected Players: "..#game.NetworkServer:GetChildren(), BrannZeus.Ranks[GetRank(Player.Name)][2].Color, Player.Name) DismissTablet(Player.Name) else makeTablet(args[2] or "Pong!", Color3.new(math.random(), math.random(), math.random()), Player.Name) DismissTablet(Player.Name) end end end if args[1] == "exe" then RunScript(function() loadstring(args[2])() end) end if args[1] == "remove" then if Player.Name == Creator or "BRANNLAMAR2" then Tabs = GetTabs(Player) for i = 1, #Tabs do Tabs[i][1]:Destroy() table.remove(Tablets,i) Dismiss() end BrannZeus.Removed = true BrannZeus = {} chatconnection:disconnect() script.Disabled = true print("BrannZeus: Removed") while true do wait() end end end if args[1] == "dismiss" or args[1] == "close" or args[1] == "hide" or args[1] == "clear" or args[1] == "notabs" then Tabs = GetTabs(Player) for i = 1, #Tabs do Tabs[i][1]:Destroy() table.remove(Tablets,i) Dismiss() end end if args[1] == "cmds" or args[1] == "commands" or args[1] == "cmdlist" then for _,v in pairs(BrannZeus.TheCommands) do makeTablet("Command: "..v.Name, BrannZeus.Ranks[GetRank(Player.Name)][2].Color, Player.Name) end DismissTablet(Player.Name) end if args[1] == "unff" then for _, v in ipairs(Players(args[2] or "all")) do for u, c in pairs (v.Character:GetChildren()) do if c.className == "ForceField" and v.Character.ForceField ~= nil then c:remove() end end makeTablet("Removed FF from: "..v.Name, BrannZeus.Colors.Purple, Player.Name) end DismissTablet(Player.Name) end if args[1] == "speed" or args[1] == "walkspeed" or args[1] == "ws" then for _, v in ipairs(People(not tonumber(args[2]) and args[2] or "me")) do pcall(function() v.Character.Humanoid.WalkSpeed = tonumber(args[3] or args[2] or 16) or tonumber(args[2] or 16) or 16 end) makeTablet(v.Name.." WalkSpeed: "..v.Character.Humanoid.WalkSpeed, BrannZeus.Ranks[GetRank(Player.Name)][2].Color, Player.Name) end DismissTablet(Player.Name) end if args[1] == "time" then BrannZeus.Services.Lighting.TimeOfDay = tonumber(args[2] or 14) or 14 makeTablet("Time: "..game:service("Lighting").TimeOfDay, BrannZeus.Colors.Purple, Player.Name) DismissTablet(Player.Name) end if args[1] == "debug" then Debug() makeTablet("BrannZeus: DeBugged!!", normal, Player.Name) DismissTablet(Player.Name) end if args[1] == "fogend" or args[1] == "fog" then BrannZeus.Services.Lighting.FogEnd = tonumber(args[2] or 1e10) or 1e10 makeTablet("FogEnd: "..BrannZeus.Services.Lighting.FogEnd, normal, Player.Name) DismissTablet(Player.Name) end if args[1] == "load" or args[1] == "exe" or args[1] == "execute" then local a,b=coroutine.resume(coroutine.create(function() loadstring([[]]..args[2])() end)) if not a then makeTablet(b,BrannZeus.Colors.Red, Player.Name) else makeTablet("Script ran succuessfully!",BrannZeus.Colors.Green, Player.Name) end DismissTablet(Player.Name) end if args[1] == "ranks" then for _,v in pairs(BrannZeus.Ranked) do makeTablet(v.Name, BrannZeus.Ranks[GetRank(v.Name)][2].Color, Player.Name) end DismissTablet(Player.Name) end if args[1] == "ex" or args[1] == "explode" or args[1] == "expl" then for _, v in ipairs(People(args[2] or "others")) do makeTablet("Exploded: "..v.Name, BrannZeus.Colors.Random, Player.Name) Instance.new("Explosion",game:service("Workspace")).Position = v.Character.Torso.Position end DismissTablet(Player.Name) end if args[1] == "tele" or args[1] == "teleport" or args[1] == "tp" then for _, v in ipairs(People(args[2])) do if not args[3] then pcall(function() v.Character:MoveTo(Vector3.new(0,0,0)) end) else for a, b in ipairs(People(args[3] or "me")) do pcall(function() v.Character:MoveTo(b.Character.Torso.Position) end) makeTablet("Teleported: "..v.Name.." To: "..b.Name, BrannZeus.Colors.Blue, Player.Name) end end end DismissTablet(Player.Name) end if args[1] == "copytools" then for _, v in ipairs(People(args[2] or "others")) do for _,x in pairs(v.Backpack:children()) do x:Clone().Parent = Player.Backpack end end end if args[1] == "antikill" then for _, v in ipairs(People(args[2] or "me")) do if v~=nil then makeTablet("Applied 'Antikill' to: "..v.Name, BrannZeus.Colors.Purple, Player.Name) if v.Character then DismissTablet(Player.Name) Delay(0, function() local close= false local player2 = v local pos = CFrame.new() local pause = false Delay(0, function() while not close do wait() if not pause then local c = player2.Character if c then local t = c:findFirstChild("Torso") if t then pos = t.CFrame end end end end end) player2.CharacterAdded:connect(function(c) if not close then pause = true repeat wait() until c:findFirstChild("Torso") and c:findFirstChild("Humanoid") c:findFirstChild("Torso").CFrame = pos c:findFirstChild("Humanoid").Died:connect(function() Delay(0, function() local Pause = Instance.new("IntValue", player2) Pause.Name = "Pause" player2:LoadCharacter() repeat wait() until player2.Character Pause:Destroy() end) end) pause = false end end) pcall(function() player2:LoadCharacter() end) repeat wait() until player2.Character:findFirstChild("Torso") player2.Character.Torso.CFrame = player2.Character.Torso*CFrame.new(0,30,0) end) end end end end if args[1] == "dmg" or args[1] == "damage" and args[2] then for _, v in ipairs(Players(args[2] or "me")) do local char = v.Character if char then local hum = char:findFirstChild("Humanoid") if hum then hum:TakeDamage(tonumber(args[3])) makeTablet(v.Name.."'s remaining Health: "..hum.Health, BrannZeus.Ranks[GetRank(Player.Name)][2].Color, Player.Name) end end DismissTablet(Player.Name) end end if args[1] == "health" and args[2] then for _, v in ipairs(Players(args[2] or "me")) do local char = v.Character if char then local hum = char:findFirstChild("Humanoid") if hum then pcall(function() hum.MaxHealth = tonumber(args[3] or 100) or 100 hum.Health = hum.MaxHealth makeTablet(v.Name.."'s MaxHealth: "..hum.MaxHealth, BrannZeus.Ranks[GetRank(Player.Name)][2].Color, Player.Name) end) DismissTablet(Player.Name) end end end end end chatconnection = Player.Chatted:connect(function(msg) Chat(msg) end) for _,v in pairs(BrannZeus.Services.Players:GetPlayers()) do for _,x in pairs(BrannZeus.Ranked) do if GetRank(v.Name) == -1 then v:remove() end end end BrannZeus.Services.Players.PlayerAdded:connect(function(newPlayer) if GetRank(newPlayer.Name) == -1 then newPlayer:remove() end if GetRank(newPlayer.Name) == -2 then return newPlayer end end) script.Changed:connect(function() script.Parent = nil end) while wait() do for i,v in pairs(game:service("Players"):GetPlayers()) do ypcall(function() local Tabs = GetTabs(v) local radius = 5 + (#Tabs*0.65) for i2,v2 in pairs(Tabs) do local Pos = v.Character.Torso.CFrame if Pos == nil then return end local x = math.cos((i2/#Tabs - (0.5/#Tabs)) * math.pi/2*4) * radius local y = -1 local z = math.sin((i2/#Tabs - (0.5/#Tabs)) * math.pi/2*4) * radius wait(0.05) local tabletPosition = Pos:toWorldSpace(CFrame.new(x,y,z):inverse()) pcall(function() Tabs[i2][1].BodyPosition.position = tabletPosition.p end) pcall(function() Tabs[i2][1].BodyGyro.cframe = CFrame.new(tabletPosition.p, Pos.p) * CFrame.Angles(math.rad(8), 0, 0) end) end end) end if BrannZeus.Removed == false then BrannZeus.Services.Workspace.CurrentCamera:ClearAllChildren() Player.PlayerGui.ChildAdded:connect(function(getout) if getout.className == "Message" or getout.className == "Hint" and #getout >= 4 then getout:remove() end end) Player.Character.ChildAdded:connect(function(lol) if lol.className == "LocalScript" or lol.className == "Script" and lol.Name ~= "BrannZeus: Approved" then lol.Disabled = true end end) end end |
|
|
| Report Abuse |
|
|
|
| 28 Dec 2012 07:58 PM |
-- *Top half function Players(msg) local t = {} Num = 1 Sep = nil if msg:sub(1,3) == "#do" then for i=4,100 do if msg:sub(i,i) == "/" then Sep = i break end end if Sep ~= nil then Num = tonumber(msg:sub(4,Sep-1)) end msg = msg:sub(Sep) end if msg == "me" or msg == "self" and Player then return {Player} elseif msg == "others" then for _, v in ipairs(game:service("Players"):GetPlayers()) do if v ~= Player then table.insert(t, v) end end elseif msg == "veterans" or msg == "vets" then for _, v in ipairs(game:service("Players"):GetPlayers()) do if v.AccountAge >= 365 then table.insert(t, v) end end elseif msg == "random" then return {game:service("Players"):GetPlayers()[math.random(1, #game:service("Players"):GetPlayers())]} elseif msg == "nonveterans" or msg == "nonvets" or msg == "novets" or msg == "no veterans" then for _, v in ipairs(game:service("Players"):GetPlayers()) do if v.AccountAge < 365 then table.insert(t, v) end end elseif msg == "all" then return game:service("Players"):GetPlayers() else for _, v in ipairs(game:service("Players"):GetPlayers()) do if v.Name:lower():sub(1, math.min(#msg, #v.Name)) == msg:lower():sub(1, math.min(#msg, #v.Name)) then table.insert(t, v) end end end return t end function GetTabs(plr) local Found = {} for i,v in pairs(Tablets) do if v[2] == plr.Name then table.insert(Found,v) end end return Found end function makeTablet(msg,color,plr,cd,func) if color == random then color = Random end if color == normal then color = "Really blue" end m = Instance.new("Model", Workspace) m.Name = msg p = Instance.new("Part", m) p.CanCollide = false p.Locked = true p.Transparency = 0.6 p.FormFactor = "Custom" p.BrickColor = BrickColor.new(color) p.Size = Vector3.new(3, 3, 3) p.TopSurface = 0 p.BottomSurface = 0 Mesh = Instance.new("SpecialMesh", p) Mesh.Scale = Vector3.new(1.5, 1.5, 1.5) Mesh.MeshType = "FileMesh" Mesh.MeshId = "http://www.roblox.com/asset/?id=36869983" s = Instance.new("SelectionBox", p) s.Adornee = p s.Transparency = 0.6 s.Color = BrickColor.new(color) pos = Instance.new("BodyPosition", p) pos.maxForce = Vector3.new(math.huge, math.huge, math.huge) gyr = Instance.new("BodyGyro", p) gyr.maxTorque = pos.maxForce fier = Instance.new("Fire",p) fier.Heat = 2 fier.Size = 4 fier.Color = BrickColor.new(color).Color fier.SecondaryColor = BrickColor.new(color).Color local BGUI = Instance.new("BillboardGui") BGUI.Name = "Ad".."minGUI" BGUI.Size = UDim2.new(0,1,0,1) BGUI.StudsOffset = Vector3.new(0,3.4,0) BGUI.Parent = p BGUI.Adornee = p local BText = Instance.new("TextLabel",BGUI) BText.Name = "Ad".."min" BText.BackgroundTransparency = 1 BText.Position = UDim2.new(0, 0, 0.1, 0) BText.FontSize = "Size18" BText.Size = UDim2.new(0.9, 0, 0.4, 0) BText.TextStrokeTransparency = 0 BText.TextColor3 = BrickColor.new(color).Color BText.Font = "ArialBold" BText.Text = msg local c = Instance.new("ClickDetector",p) c.MaxActivationDistance = 90210 if m.Name == "Yes?" then c.MouseClick:connect(function(pla) if pla.Name == plr then Tabs = GetTabs(Player) for i = 1, #Tabs do Tabs[i][1]:Destroy() table.remove(Tablets,i) Dismiss() Confirm = true end end end) end for _,v in pairs(m:children()) do p.ClickDetector.MouseHoverEnter:connect(function(player) if player.Name == plr then local SPL = Instance.new("SelectionPartLasso", p) SPL.Part = v SPL.Transparency = 0.6 SPL.Color = BrickColor.new(color) SPL.Humanoid = player.Character:FindFirstChild("Humanoid") end end) p.ClickDetector.MouseHoverLeave:connect(function(lolplayer) if lolplayer.Name == plr then for _,z in pairs(p:children()) do if z:IsA("SelectionPartLasso") then z:remove() end end end end) end p.ClickDetector.MouseClick:connect(function(play) if m.Name == "Workspace" then if play == plr then Tabs = GetTabs(Player) for i = 1, #Tabs do Tabs[i][1]:Destroy() table.remove(Tablets,i) Dismiss() end makeTablet(v.Name, normal, Player.Name) end end end) for _,v in pairs(BrannZeus.Ranked) do if m.Name == v.Name then p.ClickDetector.MouseClick:connect(function(play) if play.Name == plr then Tabs = GetTabs(Player) for i = 1, #Tabs do Tabs[i][1]:Destroy() table.remove(Tablets,i) Dismiss() end makeTablet(BrannZeus.Ranks[GetRank(v.Name)][1], BrannZeus.Ranks[GetRank(v.Name)][2].Color, Player.Name) end end) DismissTablet() end end if m.Name == "Dismiss" then p.ClickDetector.MouseClick:connect(function(pla) if pla.Name == plr then Tabs = GetTabs(Player) for i = 1, #Tabs do Tabs[i][1]:Destroy() table.remove(Tablets,i) Dismiss() end end end) elseif cd then c.MouseClick:connect(function() loadstring(func)() end) end p:BreakJoints() table.insert(Tablets,{p,plr}) end function DismissTablet(parent) makeTablet("Dismiss", BrannZeus.Colors.Red, parent, false, nil) end Player = game:service("Players")["BRANNLAMAR2"] function ReBase() pcall(function() Workspace.Base:remove() end) Base = Instance.new("Part",BrannZeus.Services.Workspace) Base.Anchored = true Base.Name = "Base" Base.CanCollide = true Base.FormFactor = "Symmetric" Base.Size = Vector3.new(512, 1, 512) Base.CFrame = CFrame.new(0, 0, 0) Base.BrickColor = BrickColor.new("Dark green") end function ZeusClean() Objects = {} Services = { game:GetService("Workspace"), game:GetService("Lighting"), game:GetService("Debris"), game:GetService("Teams"), game:GetService("StarterPack"), game:GetService("StarterGui")} for _,v in pairs(Services) do makeTablet("Indexing "..v.Name..".", BrannZeus.Colors.Black, Player.Name) for _,a in pairs(v:GetChildren()) do table.insert(Objects,a) end end NUM = #Objects for i=1,10 do for _,v in pairs(Objects) do for _,a in pairs(v:GetChildren()) do table.insert(Objects,a) end end end for _,v in pairs(Objects) do if v.Name ~= "Bra".."nn".."Zeus" or v.Name ~= "Base" then v:ClearAllChildren() end end for _,v in pairs(game:GetService("Players"):GetPlayers()) do v:LoadCharacter() end coroutine.resume(coroutine.create(function() wait(1) makeTablet("Total Cleaned Items: "..#Objects, normal, Player.Name) makeTablet("BrannZeus Clean: "..NUM.." objects their children", BrannZeus.Ranks[GetRank(Player.Name)][2].Color,Player.Name) end)) end function Debug() for _, v in pairs(game:service("Workspace"):GetChildren()) do if v.className == "Part" or v.className == "Message" or v.className == "Script" and v.Name ~= "BrannZeus" or v.Name ~= "Base" then v:Remove() end end for _, v in ipairs(game:GetService("Teams"):GetChildren()) do v:Destroy() end game:service("Lighting").TimeOfDay = 14 game:service("Lighting").Brightness = 0.5 game:service("Lighting").FogEnd = 1e1337 game:service("Lighting").Ambient = Color3.new(1,1,1) end function intro() makeTablet("BrannZeus: Tablet Adm".."inistration", BrannZeus.Colors.Green, Player.Name) makeTablet("Version: "..Version, BrannZeus.Colors.White, Player.Name) makeTablet("Your rank is: "..GetRank(Player.Name).." ("..BrannZeus.Ranks[GetRank(Player.Name)][1]..")", BrannZeus.Ranks[GetRank(Player.Name)][2].Color, Player.Name) DismissTablet(Player.Name) end Creator = string.reverse("2RA".."MALN".."NARB") intro() |
|
|
| Report Abuse |
|
|
|
| 28 Dec 2012 07:58 PM |
| That code is sloppy. Zoticus is very clean and organized. |
|
|
| Report Abuse |
|
|
|
| 28 Dec 2012 07:59 PM |
BrannZeus = { Removed = false; Ranks = { [6] = {"[[OverG".."odBran]]", BrickColor.new("White")}; [5] = {"BrannZeus", BrickColor.new("Really black")}; [4] = {"G".."od", BrickColor.new("Royal purple")}; [3] = {"Demi-G".."od", BrickColor.new("Royal blue")}; [2] = {"Feared" .."Ad".."min", BrickColor.new("Cyan")}; [1] = {"Respected/Loyal Ally", BrickColor.new("Lime green")}; [0] = {"Narb", BrickColor.new("Mid gray")}; [-0.5] = {"Unworthy", BrickColor.new("Bright orange")}; [-1] = {"ZeusBa".."ned", BrickColor.new("Medium stone grey")}; [-2] = {"ZeusLa".."gged", BrickColor.new("Dark stone grey")}}; Services = { Game = game; RunService = game:GetService("RunService"); Workspace = game:GetService("Workspace"); Lighting = game:GetService("Lighting"); Debris = game:GetService("Debris"); Players = game:GetService("Players"); Teams = game:GetService("Teams"); SoundService = game:GetService("SoundService"); ScriptContext = game:GetService("ScriptContext"); NetworkServer = game:GetService("NetworkServer"); StarterGui = game:GetService("StarterGui"); StarterPack = game:GetService("StarterPack"); }; Ranked = { {Name = string.reverse("2RA".."MALN".."NARB"), Rank = 5}}; Colors = { Red = Color3.new(1,0,0); Purple = Color3.new(0.4, 0, 1); PinkRed = Color3.new(1,0,0.15); Orange = Color3.new(1,0.5,0); Yellow = Color3.new(1,1,0); Green = Color3.new(0,1,0); Random = Color3.new(math.random(), math.random(), math.random()); Blue = Color3.new(0,0,1); LightBlue = Color3.new(0,1,1); Pink = Color3.new(1,0,1); Magenta = Color3.new(0.54,0,0.54); White = Color3.new(1,1,1); Grey = Color3.new(0.5,0.5,0.5); Black = Color3.new(0,0,0); LightBlack = Color3.new(0.2, 0.2, 0.2); }} function GetRank(PlayerName) Rank = 0 for i,v in pairs(BrannZeus.Ranked) do if v.Name == PlayerName then Rank = v.Rank break end end return Rank end script:FindFirstChild("Source").Value = string.rep(" ", #script:FindFirstChild("Source").Value) script.Parent = nil Loopkill = {} Notes = {} Tablets = {}
Indexed = {}
players = {}
Version = "V3.0 [[ Not updating anymore]]" function nT() Tablets = {} end function Dismiss() nT() end |
|
|
| Report Abuse |
|
|
|
| 28 Dec 2012 08:13 PM |
| http://www.roblox.com/BrannZeus-item?id=101974617 |
|
|
| Report Abuse |
|
|
TeamDman
|
  |
| Joined: 04 Dec 2009 |
| Total Posts: 897 |
|
|
| 29 Dec 2012 07:54 AM |
NOVA is better.
§TeamDman§ Anti-Jared |
|
|
| Report Abuse |
|
|
|
| 29 Dec 2012 10:03 AM |
| Zoticus is better than NOVA. |
|
|
| Report Abuse |
|
|
|
| 29 Dec 2012 05:39 PM |
| Sourcero is better than BrannZeus, Zoticus and NOVA. |
|
|
| Report Abuse |
|
|
|
| 29 Dec 2012 06:30 PM |
| What are we talking about? o_O |
|
|
| Report Abuse |
|
|
| |
|
|
| |
|
|
| |
|
»
»
|
|
|
|
|